Products 52448-14-3
CAS 52448-14-3 appears in our catalog under these names: 4-Chloro-l-tryptophan, 95%, 4–Chloro–L–tryptophan, 4-Chloro-L-tryptophan, H-Trp(4-Cl)-OH 95%, 4-Chloro-L-tryptophan, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 2g, 10g, 25g, 100mg.
(2S)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid (CAS 52448-14-3) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: (2S)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid. InChIKey: NRTHKYABOMUPSC-QMMMGPOBSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid |
| InChIKey | NRTHKYABOMUPSC-QMMMGPOBSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)