Products 2755780-15-3
CAS 2755780-15-3 is the registry number for tert-Butyl ((2S)-1-cyano-1-hydroxy-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)carbamate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl N-[(2S)-1-cyano-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamate (CAS 2755780-15-3) is a chemical compound with the molecular formula C13H21N3O4 and a molecular weight of 283.32 g/mol. IUPAC name: tert-butyl N-[(2S)-1-cyano-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamate. InChIKey: MFOFWQKEGBTFIU-XMCUXHSSSA-N.
| Molecular formula | C13H21N3O4 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-cyano-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamate |
| InChIKey | MFOFWQKEGBTFIU-XMCUXHSSSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@@H]1CCNC1=O)C(C#N)O |
Computed by PubChem (NCBI)