Products 2933217-25-3
CAS 2933217-25-3 is the registry number for tert-Butyl (3S,5S)-3-carbamoyl-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (5S,8S)-8-carbamoyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate (CAS 2933217-25-3) is a chemical compound with the molecular formula C13H21N3O4 and a molecular weight of 283.32 g/mol. IUPAC name: tert-butyl (5S,8S)-8-carbamoyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate. InChIKey: OHNDBRVEGWYVRR-SDBXPKJASA-N.
| Molecular formula | C13H21N3O4 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | tert-butyl (5S,8S)-8-carbamoyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate |
| InChIKey | OHNDBRVEGWYVRR-SDBXPKJASA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(CCNC2=O)C[C@H]1C(=O)N |
Computed by PubChem (NCBI)