Products 2918975-96-7

CAS 2918975-96-7 is the registry number for 1-(tert-Butyl) 2-methyl 5-(cyanomethyl)piperazine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl 5-(cyanomethyl)piperazine-1,2-dicarboxylate (CAS 2918975-96-7) is a chemical compound with the molecular formula C13H21N3O4 and a molecular weight of 283.32 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 5-(cyanomethyl)piperazine-1,2-dicarboxylate. InChIKey: GECLGLKBCBFCIS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21N3O4
Molecular weight283.32 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 5-(cyanomethyl)piperazine-1,2-dicarboxylate
InChIKeyGECLGLKBCBFCIS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(NCC1C(=O)OC)CC#N

Computed by PubChem (NCBI)