Products 2755892-69-2
CAS 2755892-69-2 is the registry number for 2-(6-(DIFLUOROMETHOXY)PYRIDIN-3-YL)PROPANOIC ACID, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[6-(difluoromethoxy)-3-pyridinyl]propanoic acid (CAS 2755892-69-2) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 2-[6-(difluoromethoxy)-3-pyridinyl]propanoic acid. InChIKey: VQGOUXYZHKFAST-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | 2-[6-(difluoromethoxy)-3-pyridinyl]propanoic acid |
| InChIKey | VQGOUXYZHKFAST-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)