Products 2755894-09-6

CAS 2755894-09-6 is the registry number for 2-Fluoro-2-(5-fluoro-2-methoxypyridin-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-fluoro-2-(5-fluoro-2-methoxy-4-pyridinyl)propanoic acid (CAS 2755894-09-6) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 2-fluoro-2-(5-fluoro-2-methoxy-4-pyridinyl)propanoic acid. InChIKey: IANCRFYFSNHFMY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9F2NO3
Molecular weight217.17 g/mol
IUPAC name2-fluoro-2-(5-fluoro-2-methoxy-4-pyridinyl)propanoic acid
InChIKeyIANCRFYFSNHFMY-UHFFFAOYSA-N
SMILESCC(C1=CC(=NC=C1F)OC)(C(=O)O)F

Computed by PubChem (NCBI)