Products 2756011-83-1
CAS 2756011-83-1 is the registry number for Secoaristolenedioic acid. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(5R,6R)-6-[(1S,3R)-3-carboxy-2,2-dimethylcyclopropyl]-5,6-dimethylcyclohexene-1-carboxylic acid (CAS 2756011-83-1) is a chemical compound with the molecular formula C15H22O4 and a molecular weight of 266.33 g/mol. IUPAC name: (5R,6R)-6-[(1S,3R)-3-carboxy-2,2-dimethylcyclopropyl]-5,6-dimethylcyclohexene-1-carboxylic acid. InChIKey: SBXFQNWDMHXJRV-HFJLCZBOSA-N.
| Molecular formula | C15H22O4 |
|---|---|
| Molecular weight | 266.33 g/mol |
| IUPAC name | (5R,6R)-6-[(1S,3R)-3-carboxy-2,2-dimethylcyclopropyl]-5,6-dimethylcyclohexene-1-carboxylic acid |
| InChIKey | SBXFQNWDMHXJRV-HFJLCZBOSA-N |
| SMILES | C[C@@H]1CCC=C([C@@]1(C)[C@H]2[C@H](C2(C)C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Secoaristolenedioic acid, orb2813811