CAS 2756181-28-7 appears in our catalog under these names: 4-Bromo-2,3-dimethyl-6-nitrophenol, 95%, 4-Bromo-2,3-dimethyl-6-nitrophenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-bromo-2,3-dimethyl-6-nitrophenol (CAS 2756181-28-7) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 4-bromo-2,3-dimethyl-6-nitrophenol. InChIKey: CHDDEOKFSGSBTF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 4-bromo-2,3-dimethyl-6-nitrophenol |
| InChIKey | CHDDEOKFSGSBTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1C)O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)