CAS 2756525-50-3 is the registry number for 2-Methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine (CAS 2756525-50-3) is a chemical compound with the molecular formula C17H22BNO3 and a molecular weight of 299.2 g/mol. IUPAC name: 2-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine. InChIKey: ANUPOCSFTUOEMC-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO3 |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 2-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
| InChIKey | ANUPOCSFTUOEMC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CC(=C3N)OC |
Computed by PubChem (NCBI)