CAS 2818959-30-5 is the registry number for 8-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2818959-30-5) is a chemical compound with the molecular formula C17H22BNO3 and a molecular weight of 299.2 g/mol. IUPAC name: 8-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: BRFRHBLGQQMYFP-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO3 |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | 8-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | BRFRHBLGQQMYFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=NC3=C(C=C2)OCC |
Computed by PubChem (NCBI)