CAS 2757083-15-9 appears in our catalog under these names: (S)-2-(5-Fluoropyridin-2-yl)-4-isopropyl-4,5-dihydrooxazole, 97% 99%ee, 97% 99%ee, (S)-2-(5-Fluoropyridin-2-yl)-4-isopropyl-4,5-dihydrooxazole, 97% 99%ee. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g.
(4S)-2-(5-fluoro-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole (CAS 2757083-15-9) is a chemical compound with the molecular formula C11H13FN2O and a molecular weight of 208.23 g/mol. IUPAC name: (4S)-2-(5-fluoro-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: WDYXEXPXLJSQFV-SNVBAGLBSA-N.
| Molecular formula | C11H13FN2O |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | (4S)-2-(5-fluoro-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | WDYXEXPXLJSQFV-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=NC=C(C=C2)F |
Computed by PubChem (NCBI)