Products 2757083-16-0
CAS 2757083-16-0 is the registry number for (S)-2-(5-Fluoropyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
(4S)-2-(5-fluoro-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 2757083-16-0) is a chemical compound with the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. IUPAC name: (4S)-2-(5-fluoro-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: UUMDPJIUTBJOSQ-CYBMUJFWSA-N.
| Molecular formula | C14H11FN2O |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | (4S)-2-(5-fluoro-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | UUMDPJIUTBJOSQ-CYBMUJFWSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=NC=C(C=C2)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)