Products 2757287-51-5
CAS 2757287-51-5 is the registry number for (2S,2'S)-2,2'-Bipyrrolidine dihydrochloride, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(2S)-2-[(2S)-pyrrolidin-2-yl]pyrrolidine;dihydrochloride (CAS 2757287-51-5) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: (2S)-2-[(2S)-pyrrolidin-2-yl]pyrrolidine;dihydrochloride. InChIKey: OCIWKVITVUFWTF-FOMWZSOGSA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (2S)-2-[(2S)-pyrrolidin-2-yl]pyrrolidine;dihydrochloride |
| InChIKey | OCIWKVITVUFWTF-FOMWZSOGSA-N |
| SMILES | C1C[C@H](NC1)[C@@H]2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)