CAS 2758134-82-4 is the registry number for 9,9-Dimethyl-5-phenyl-9H-fluoren-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9,9-dimethyl-5-phenylfluoren-2-amine (CAS 2758134-82-4) is a chemical compound with the molecular formula C21H19N and a molecular weight of 285.4 g/mol. IUPAC name: 9,9-dimethyl-5-phenylfluoren-2-amine. InChIKey: VUOCNLGHWLEOPN-UHFFFAOYSA-N.
| Molecular formula | C21H19N |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 9,9-dimethyl-5-phenylfluoren-2-amine |
| InChIKey | VUOCNLGHWLEOPN-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC(=C2C3=C1C=C(C=C3)N)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)