CAS 717880-39-2 appears in our catalog under these names: 9,9-Dimethyl-10-phenyl-9,10-dihydroacridine, 95%, 9,9–Dimethyl–10–phenyl–9,10–dihydroacridine, 9,9-Dimethyl-10-phenyl-9,10-dihydroacridine, >98.0%(GC), 9,9-Dimethyl-10-phenyl-9,10-dihydroacridine, 98%, 98%, 9,9-DIMETHYL-10-PHENYL-9,10-DIHYDROACRIDINE, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 100mg, 250mg, 5g.
9,9-dimethyl-10-phenylacridine (CAS 717880-39-2) is a chemical compound with the molecular formula C21H19N and a molecular weight of 285.4 g/mol. IUPAC name: 9,9-dimethyl-10-phenylacridine. InChIKey: CKTUEZIFXPDRMO-UHFFFAOYSA-N.
| Molecular formula | C21H19N |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 9,9-dimethyl-10-phenylacridine |
| InChIKey | CKTUEZIFXPDRMO-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C3=CC=CC=C31)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)