CAS 891503-75-6 is the registry number for 1,2-Dimethyl-1-(phenylmethyl)-1h-benz[e]indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-benzyl-1,2-dimethylbenzo[e]indole (CAS 891503-75-6) is a chemical compound with the molecular formula C21H19N and a molecular weight of 285.4 g/mol. IUPAC name: 1-benzyl-1,2-dimethylbenzo[e]indole. InChIKey: SUUPXNJGESLRBB-UHFFFAOYSA-N.
| Molecular formula | C21H19N |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 1-benzyl-1,2-dimethylbenzo[e]indole |
| InChIKey | SUUPXNJGESLRBB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)CC3=CC=CC=C3)C4=CC=CC=C4C=C2 |
Computed by PubChem (NCBI)