CAS 275826-34-1 appears in our catalog under these names: (S)-3-Amino-3-(2-bromo-phenyl)-propionic acid, 97%, (S)–3–Amino–3–(2–bromophenyl)propanoic acid, H-β-Phe(2-Br)-OH 98%, (S)-3-Amino-3-(2-bromophenyl)propanoic acid, 98%, 98%, (S)-3-Amino-3-(2-bromophenyl)propanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
(3S)-3-amino-3-(2-bromophenyl)propanoic acid (CAS 275826-34-1) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3S)-3-amino-3-(2-bromophenyl)propanoic acid. InChIKey: OETRFEPZCAGEMK-QMMMGPOBSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3S)-3-amino-3-(2-bromophenyl)propanoic acid |
| InChIKey | OETRFEPZCAGEMK-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CC(=O)O)N)Br |
Computed by PubChem (NCBI)