CAS 2758531-21-2 appears in our catalog under these names: 3-(4-Hydroxyphenyl)piperidine-2,6-dione, 98%, 98%, CRBN ligand-885, 98.10%, 3-(4-Hydroxyphenyl)piperidine-2,6-dione, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 100 mg, 1 g, 250 mg.
3-(4-hydroxyphenyl)piperidine-2,6-dione (CAS 2758531-21-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 3-(4-hydroxyphenyl)piperidine-2,6-dione. InChIKey: BCHCLMHWEXVCBY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)piperidine-2,6-dione |
| InChIKey | BCHCLMHWEXVCBY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)