Products 2760-98-7
CAS 2760-98-7 appears in our catalog under these names: Isophthalohydrazide, 98%, 98%, Isophthalohydrazide, 98%, Isophthalic Dihydrazide, Isophthalic Dihydrazide, >95.0%(HPLC)(T), Isophthalic Dihydrazide. Offered by: Chemat, Fluorochem, GLPBio, TCI, Biosynth. Available pack sizes: 25g, 100g, 500g, 1kg, 1g, 10g, 1000g.
Benzene-1,3-dicarbohydrazide (CAS 2760-98-7) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: benzene-1,3-dicarbohydrazide. InChIKey: UTTHLMXOSUFZCQ-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | benzene-1,3-dicarbohydrazide |
| InChIKey | UTTHLMXOSUFZCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)NN)C(=O)NN |
Computed by PubChem (NCBI)
Synonyms:
Isophthalic dihydrazide, Isophthalohydrazide, Isophthalyl dihydrazide, Isophthalic acid dihydrazide, 1,3-Benzenedicarboxylic acid, dihydrazide, Isophthalic hydrazide, Isophthalic acid hydrazide, Isophthalic acid, dihydrazide, 1,3-Benzenedicarboxylic acid, 1,3-dihydrazide, 1,3-Phenylenebiscarbohydrazide