CAS 27602-75-1 appears in our catalog under these names: Naproxen Impurity 3, Naproxen Impurity 42, Naproxenal. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-(6-methoxynaphthalen-2-yl)propanal (CAS 27602-75-1) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)propanal. InChIKey: RCGQAPUWWHXBOK-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)propanal |
| InChIKey | RCGQAPUWWHXBOK-UHFFFAOYSA-N |
| SMILES | CC(C=O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)