CAS 27602-76-2 appears in our catalog under these names: 2-(6-Methoxy-2-naphthyl)propionaldehyde oxime, Naproxen Impurity 4. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
(NE)-N-[2-(6-methoxynaphthalen-2-yl)propylidene]hydroxylamine (CAS 27602-76-2) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: (NE)-N-[2-(6-methoxynaphthalen-2-yl)propylidene]hydroxylamine. InChIKey: NNNLDUINFHSKNG-OQLLNIDSSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (NE)-N-[2-(6-methoxynaphthalen-2-yl)propylidene]hydroxylamine |
| InChIKey | NNNLDUINFHSKNG-OQLLNIDSSA-N |
| SMILES | CC(/C=N/O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)