Products 2760464-19-3
CAS 2760464-19-3 is the registry number for 1-(9H-Fluoren-9-ylmethyl) (2S)-2-(2-propen-1-yl)-1,2-pyrrolidinedicarboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2-prop-2-enylpyrrolidine-2-carboxylic acid (CAS 2760464-19-3) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2-prop-2-enylpyrrolidine-2-carboxylic acid. InChIKey: ZZYQUDUWULJEHG-HSZRJFAPSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2-prop-2-enylpyrrolidine-2-carboxylic acid |
| InChIKey | ZZYQUDUWULJEHG-HSZRJFAPSA-N |
| SMILES | C=CC[C@@]1(CCCN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)