CAS 2760490-52-4 is the registry number for 2-Methyl-5-(5-methyl-3,4,5,6-tetrahydropyridin-2-yl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-1,3-benzothiazole (CAS 2760490-52-4) is a chemical compound with the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. IUPAC name: 2-methyl-5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-1,3-benzothiazole. InChIKey: COOMGDQADHDAFA-UHFFFAOYSA-N.
| Molecular formula | C14H16N2S |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | 2-methyl-5-(3-methyl-2,3,4,5-tetrahydropyridin-6-yl)-1,3-benzothiazole |
| InChIKey | COOMGDQADHDAFA-UHFFFAOYSA-N |
| SMILES | CC1CCC(=NC1)C2=CC3=C(C=C2)SC(=N3)C |
Computed by PubChem (NCBI)