Products 4602-36-2
CAS 4602-36-2 appears in our catalog under these names: 3-Phenyl-1,4-diazaspiro[4.5]dec-3-ene-2-thione, 90%, 3–Phenyl–1，4–diazaspiro(4·5)dec–3–ene–2–thione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 500mg.
3-phenyl-1,4-diazaspiro[4.5]dec-3-ene-2-thione (CAS 4602-36-2) is a chemical compound with the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. IUPAC name: 3-phenyl-1,4-diazaspiro[4.5]dec-3-ene-2-thione. InChIKey: QFNMCEHDUIVPLO-UHFFFAOYSA-N.
| Molecular formula | C14H16N2S |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | 3-phenyl-1,4-diazaspiro[4.5]dec-3-ene-2-thione |
| InChIKey | QFNMCEHDUIVPLO-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)NC(=S)C(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)