CAS 931593-71-4 is the registry number for N-Cyclopropyl-4-(3,4-dimethylphenyl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclopropyl-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine (CAS 931593-71-4) is a chemical compound with the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. IUPAC name: N-cyclopropyl-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: WEDVPQQKTHRDFX-UHFFFAOYSA-N.
| Molecular formula | C14H16N2S |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | N-cyclopropyl-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | WEDVPQQKTHRDFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CSC(=N2)NC3CC3)C |
Computed by PubChem (NCBI)