CAS 2762464-15-1 appears in our catalog under these names: Mescaline–d4 (hydrochloride), Mescaline–d4 (hydrochloride) (CRM). Offered by: GLPBio. Available pack sizes: 1mg, 100μg.
1,1,2,2-tetradeuterio-2-(3,4,5-trimethoxyphenyl)ethanamine;hydrochloride (CAS 2762464-15-1) is a chemical compound with the molecular formula C11H18ClNO3 and a molecular weight of 251.74 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(3,4,5-trimethoxyphenyl)ethanamine;hydrochloride. InChIKey: FVZVSNDNKMOYKF-HGFPCDIYSA-N.
| Molecular formula | C11H18ClNO3 |
|---|---|
| Molecular weight | 251.74 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(3,4,5-trimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | FVZVSNDNKMOYKF-HGFPCDIYSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C(=C1)OC)OC)OC)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)