CAS 276262-71-6 appears in our catalog under these names: 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-bromophenyl)propanoic acid, 97%, Fmoc–3–amino–3–(3–bromophenyl)–propionic acid, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-bromophenyl)propanoic acid, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(3-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 276262-71-6) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: 3-(3-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KGNRGFVZQISFCT-UHFFFAOYSA-N.
| Molecular formula | C24H20BrNO4 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | 3-(3-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KGNRGFVZQISFCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)