Products 2763158-12-7
CAS 2763158-12-7 is the registry number for Ethyl (7aS)-2-hydroxy-2-methyl-5-oxotetrahydro-1H-pyrrolizine-7a(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (8S)-6-hydroxy-6-methyl-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate (CAS 2763158-12-7) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: ethyl (8S)-6-hydroxy-6-methyl-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate. InChIKey: YIUWMWQZCUQUEH-DTIOYNMSSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | ethyl (8S)-6-hydroxy-6-methyl-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate |
| InChIKey | YIUWMWQZCUQUEH-DTIOYNMSSA-N |
| SMILES | CCOC(=O)[C@@]12CCC(=O)N1CC(C2)(C)O |
Computed by PubChem (NCBI)