Products 2763749-81-9
CAS 2763749-81-9 appears in our catalog under these names: 2,3-Dihydro-1H-indole-2-methanamine dihydrochloride, 97%, 97%, 2,3-Dihydro-1H-indole-2-methanamine dihydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,3-dihydro-1H-indol-2-ylmethanamine;dihydrochloride (CAS 2763749-81-9) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 2,3-dihydro-1H-indol-2-ylmethanamine;dihydrochloride. InChIKey: BCLNIARXHOGAKJ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 2,3-dihydro-1H-indol-2-ylmethanamine;dihydrochloride |
| InChIKey | BCLNIARXHOGAKJ-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C21)CN.Cl.Cl |
Computed by PubChem (NCBI)