Products 2763753-47-3
CAS 2763753-47-3 appears in our catalog under these names: (S)-7-(tert-Butoxycarbonyl)-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid, 97%, 97%, (S)-7-(tert-Butoxycarbonyl)-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 50mg.
(5S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid (CAS 2763753-47-3) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: (5S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid. InChIKey: PDZLNQCXTJFVLO-QMMMGPOBSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (5S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid |
| InChIKey | PDZLNQCXTJFVLO-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](OC2(C1)CC2)C(=O)O |
Computed by PubChem (NCBI)