Products 3085028-37-8
CAS 3085028-37-8 is the registry number for (R)-7-(tert-butoxycarbonyl)-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5R)-7-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid (CAS 3085028-37-8) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: (5R)-7-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid. InChIKey: PDZLNQCXTJFVLO-MRVPVSSYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (5R)-7-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxa-7-azaspiro[2.5]octane-5-carboxylic acid |
| InChIKey | PDZLNQCXTJFVLO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](OC2(C1)CC2)C(=O)O |
Computed by PubChem (NCBI)