Products 2764730-66-5
CAS 2764730-66-5 is the registry number for (2-Methoxy-5-(trifluoromethyl)phenyl)(pyrrolidin-1-yl)methanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
[2-methoxy-5-(trifluoromethyl)phenyl]-pyrrolidin-1-ylmethanone (CAS 2764730-66-5) is a chemical compound with the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. IUPAC name: [2-methoxy-5-(trifluoromethyl)phenyl]-pyrrolidin-1-ylmethanone. InChIKey: AIEXVHBWEXGPLW-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO2 |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | [2-methoxy-5-(trifluoromethyl)phenyl]-pyrrolidin-1-ylmethanone |
| InChIKey | AIEXVHBWEXGPLW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C(=O)N2CCCC2 |
Computed by PubChem (NCBI)