Products 2765091-45-8
CAS 2765091-45-8 appears in our catalog under these names: 2A3, 97.0%, 2A3, 95%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 5 mg, 10mM/1mL, 50 mg, 100 mg, 10 mg, 25 mg, 100mg, 250mg.
(2-amino-3-pyridinyl)-imidazol-1-ylmethanone (CAS 2765091-45-8) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: (2-amino-3-pyridinyl)-imidazol-1-ylmethanone. InChIKey: HTSCLDQAVWRITQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | (2-amino-3-pyridinyl)-imidazol-1-ylmethanone |
| InChIKey | HTSCLDQAVWRITQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)