Products 276702-18-2
CAS 276702-18-2 is the registry number for 2-(Acetyloxy)-6-chloro-3-nitrobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chloro-6-nitro-2-sulfamoylphenyl) acetate (CAS 276702-18-2) is a chemical compound with the molecular formula C8H7ClN2O6S and a molecular weight of 294.67 g/mol. IUPAC name: (3-chloro-6-nitro-2-sulfamoylphenyl) acetate. InChIKey: CNRSGBJHIHSXCY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O6S |
|---|---|
| Molecular weight | 294.67 g/mol |
| IUPAC name | (3-chloro-6-nitro-2-sulfamoylphenyl) acetate |
| InChIKey | CNRSGBJHIHSXCY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1S(=O)(=O)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)