CAS 571155-31-2 appears in our catalog under these names: 2-(2-Chloro-4-nitrobenzenesulfonamido)acetic acid, 2-(2-Chloro-4-nitrobenzenesulfonamido)acetic acid, 95%, (2-Chloro-4-nitro-benzenesulfonylamino)-acetic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 250mg, 100mg, 1g.
2-[(2-chloro-4-nitrophenyl)sulfonylamino]acetic acid (CAS 571155-31-2) is a chemical compound with the molecular formula C8H7ClN2O6S and a molecular weight of 294.67 g/mol. IUPAC name: 2-[(2-chloro-4-nitrophenyl)sulfonylamino]acetic acid. InChIKey: JXBAFFDNRGIBKV-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O6S |
|---|---|
| Molecular weight | 294.67 g/mol |
| IUPAC name | 2-[(2-chloro-4-nitrophenyl)sulfonylamino]acetic acid |
| InChIKey | JXBAFFDNRGIBKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)