Products 937661-09-1
CAS 937661-09-1 is the registry number for 2,4-Dimethyl-3,5-dinitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-dimethyl-3,5-dinitrobenzenesulfonyl chloride (CAS 937661-09-1) is a chemical compound with the molecular formula C8H7ClN2O6S and a molecular weight of 294.67 g/mol. IUPAC name: 2,4-dimethyl-3,5-dinitrobenzenesulfonyl chloride. InChIKey: TWOATHSLDFFDQE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O6S |
|---|---|
| Molecular weight | 294.67 g/mol |
| IUPAC name | 2,4-dimethyl-3,5-dinitrobenzenesulfonyl chloride |
| InChIKey | TWOATHSLDFFDQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)