Products 2768871-10-7
CAS 2768871-10-7 is the registry number for 3-Chloro-2-fluoro-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-2-fluoro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine (CAS 2768871-10-7) is a chemical compound with the molecular formula C10H11ClFNO and a molecular weight of 215.65 g/mol. IUPAC name: 3-chloro-2-fluoro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine. InChIKey: FPSFTMOELSZOFE-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFNO |
|---|---|
| Molecular weight | 215.65 g/mol |
| IUPAC name | 3-chloro-2-fluoro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| InChIKey | FPSFTMOELSZOFE-UHFFFAOYSA-N |
| SMILES | CC1(CC2=NC(=C(C=C2CO1)Cl)F)C |
Computed by PubChem (NCBI)