Products 2770008-35-8
CAS 2770008-35-8 is the registry number for Methyl 1,3-diacetyl-2-oxoindoline-6-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 1,3-diacetyl-2-oxo-3H-indole-6-carboxylate (CAS 2770008-35-8) is a chemical compound with the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. IUPAC name: methyl 1,3-diacetyl-2-oxo-3H-indole-6-carboxylate. InChIKey: POOTYFPZUFMBNH-UHFFFAOYSA-N.
| Molecular formula | C14H13NO5 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | methyl 1,3-diacetyl-2-oxo-3H-indole-6-carboxylate |
| InChIKey | POOTYFPZUFMBNH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C2=C(C=C(C=C2)C(=O)OC)N(C1=O)C(=O)C |
Computed by PubChem (NCBI)