Products 2770359-53-8
CAS 2770359-53-8 is the registry number for tert-butyl 4-{3-aminobicyclo[1.1.1]pentan-1-yl}piperidine-1-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl 4-(3-amino-1-bicyclo[1.1.1]pentanyl)piperidine-1-carboxylate (CAS 2770359-53-8) is a chemical compound with the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. IUPAC name: tert-butyl 4-(3-amino-1-bicyclo[1.1.1]pentanyl)piperidine-1-carboxylate. InChIKey: JUSIWFAGABKCDA-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O2 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | tert-butyl 4-(3-amino-1-bicyclo[1.1.1]pentanyl)piperidine-1-carboxylate |
| InChIKey | JUSIWFAGABKCDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C23CC(C2)(C3)N |
Computed by PubChem (NCBI)