Products 2782812-41-1
CAS 2782812-41-1 appears in our catalog under these names: 4-(2-Fluoro-6-methoxyphenyl)-6-methylnicotinic acid, 98%, 4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxylicacid, 98%, 98%, 4-(2-Fluoro-6-methoxyphenyl)-6-methylnicotinic acid, ≥95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxylic acid (CAS 2782812-41-1) is a chemical compound with the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. IUPAC name: 4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxylic acid. InChIKey: AQKVPYJNRRKCJC-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO3 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxylic acid |
| InChIKey | AQKVPYJNRRKCJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)C(=O)O)C2=C(C=CC=C2F)OC |
Computed by PubChem (NCBI)