CAS 27866-92-8 is the registry number for trans-2-Phenethylcyclohexanecarboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
Cis-(1R,2S)-2-(2-phenylethyl)cyclohexane-1-carboxylic acid (CAS 27866-92-8) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: cis-(1R,2S)-2-(2-phenylethyl)cyclohexane-1-carboxylic acid. InChIKey: UQRMUYYWGDYHMH-UONOGXRCSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | cis-(1R,2S)-2-(2-phenylethyl)cyclohexane-1-carboxylic acid |
| InChIKey | UQRMUYYWGDYHMH-UONOGXRCSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)