CAS 2787-09-9 is the registry number for DL-Chloramphenicol. Offered by: TRC, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 25g, 100g.
Chloramphenicol is an organochlorine compound that is dichloro-substituted acetamide containing a nitrobenzene ring, an amide bond and two alcohol functions. It has a role as a Mycoplasma genitalium metabolite, a geroprotector, an antimicrobial agent, an antibacterial drug, a protein synthesis inhibitor and an Escherichia coli metabolite. It is a diol, a C-nitro compound, an organochlorine compound and a carboxamide.
Source: ChEBI
| Molecular formula | C11H12Cl2N2O5 |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
| SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)