CAS 7411-65-6 appears in our catalog under these names: M-Chloramphenicol, m-nitro-(R,R)-threo-Chloramphenicol, >95% (HPLC), m–Chloramphenicol, m-threo-Chloramphenicol. Offered by: Chemat Brand, TRC, GLPBio, Chemat, HPC Standards. Available pack sizes: on request, 10mg, 1mg, 1x10mg, 1 mg.
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide (CAS 7411-65-6) is a chemical compound with the molecular formula C11H12Cl2N2O5 and a molecular weight of 323.13 g/mol. IUPAC name: 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide. InChIKey: FTMJFHVKAXPFIY-RKDXNWHRSA-N.
| Molecular formula | C11H12Cl2N2O5 |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(3-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | FTMJFHVKAXPFIY-RKDXNWHRSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)