Products 22933-62-6
CAS 22933-62-6 is the registry number for (4-Desnitro-2-nitrophenyl)-(R,R)-chloramphenicol. Offered by: TRC. Available pack sizes: 100mg.
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide (CAS 22933-62-6) is a chemical compound with the molecular formula C11H12Cl2N2O5 and a molecular weight of 323.13 g/mol. IUPAC name: 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide. InChIKey: SDQKGPHGTMIGOV-VXNVDRBHSA-N.
| Molecular formula | C11H12Cl2N2O5 |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(2-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | SDQKGPHGTMIGOV-VXNVDRBHSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)