Products 2790-09-2
CAS 2790-09-2 appears in our catalog under these names: 4,6-Dimethylisophthalic Acid, >95.0%(GC), 4,6-Dimethylisophthalic acid 98%, 4,6-Dimethylisophthalic acid, 98%, 98%. Offered by: TCI, Ambeed, Chemat. Available pack sizes: 200mg, 1g, 100mg, 250mg, 5g.
4,6-dimethylbenzene-1,3-dicarboxylic acid (CAS 2790-09-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4,6-dimethylbenzene-1,3-dicarboxylic acid. InChIKey: HAYIPGIFANTODX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4,6-dimethylbenzene-1,3-dicarboxylic acid |
| InChIKey | HAYIPGIFANTODX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)