CAS 27932-00-9 is the registry number for Phenylmalonic Acid Mono-5-indanyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid (CAS 27932-00-9) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid. InChIKey: ZPIUANRTQSWZBQ-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid |
| InChIKey | ZPIUANRTQSWZBQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OC(=O)C(C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)