Products 27932-00-9

CAS 27932-00-9 is the registry number for Phenylmalonic Acid Mono-5-indanyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid (CAS 27932-00-9) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid. InChIKey: ZPIUANRTQSWZBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16O4
Molecular weight296.3 g/mol
IUPAC name3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid
InChIKeyZPIUANRTQSWZBQ-UHFFFAOYSA-N
SMILESC1CC2=C(C1)C=C(C=C2)OC(=O)C(C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)