CAS 2794988-88-6 is the registry number for 4,4'-Diamino-[1,1'-biphenyl]-3,3',5,5'-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-amino-5-(4-amino-3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 2794988-88-6) is a chemical compound with the molecular formula C16H12N2O8 and a molecular weight of 360.27 g/mol. IUPAC name: 2-amino-5-(4-amino-3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: MJWKNUWJUXHIED-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O8 |
|---|---|
| Molecular weight | 360.27 g/mol |
| IUPAC name | 2-amino-5-(4-amino-3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | MJWKNUWJUXHIED-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)C(=O)O)C2=CC(=C(C(=C2)C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)