Products 2794988-88-6

CAS 2794988-88-6 is the registry number for 4,4'-Diamino-[1,1'-biphenyl]-3,3',5,5'-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-amino-5-(4-amino-3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 2794988-88-6) is a chemical compound with the molecular formula C16H12N2O8 and a molecular weight of 360.27 g/mol. IUPAC name: 2-amino-5-(4-amino-3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: MJWKNUWJUXHIED-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12N2O8
Molecular weight360.27 g/mol
IUPAC name2-amino-5-(4-amino-3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid
InChIKeyMJWKNUWJUXHIED-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)N)C(=O)O)C2=CC(=C(C(=C2)C(=O)O)N)C(=O)O

Computed by PubChem (NCBI)