CAS 70967-79-2 appears in our catalog under these names: 2,5-Pyrrolidinedione, 1,1'-[1,4-phenylenebis(carbonyloxy)]bis-, 95%, 2,5–Pyrrolidinedione, 1,1'–(1,4–phenylenebis(carbonyloxy))bis–, 1,4-Bis(2,5-dioxopyrrolidin-1-yl) benzene-1,4-dicarboxylate, Bis(2,5-dioxopyrrolidin-1-yl) terephthalate 95%, 1,4-Benzenedicarboxylic acid, 1,4-bis(2,5-dioxo-1-pyrrolidinyl) ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 500mg, 250mg, 1000mg, 5000mg, 100mg.
Bis(2,5-dioxopyrrolidin-1-yl) benzene-1,4-dicarboxylate (CAS 70967-79-2) is a chemical compound with the molecular formula C16H12N2O8 and a molecular weight of 360.27 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) benzene-1,4-dicarboxylate. InChIKey: CMPOTSZEEVQDLT-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O8 |
|---|---|
| Molecular weight | 360.27 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) benzene-1,4-dicarboxylate |
| InChIKey | CMPOTSZEEVQDLT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)C(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)