CAS 91779-84-9 appears in our catalog under these names: Bis(2,5-dioxopyrrolidin-1-yl) isophthalate, 98%, 2,5-Pyrrolidinedione, 1,1'-[1,3-phenylenebis(carbonyloxy)]bis-. Offered by: AmBeed, Chemat. Available pack sizes: 1g.
Bis(2,5-dioxopyrrolidin-1-yl) benzene-1,3-dicarboxylate (CAS 91779-84-9) is a chemical compound with the molecular formula C16H12N2O8 and a molecular weight of 360.27 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) benzene-1,3-dicarboxylate. InChIKey: YIFNMIBSDHKPPS-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O8 |
|---|---|
| Molecular weight | 360.27 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) benzene-1,3-dicarboxylate |
| InChIKey | YIFNMIBSDHKPPS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC(=CC=C2)C(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)