CAS 27958-06-1 is the registry number for Deacetylanisomycin. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25mg, 5mg, 5 mg.
(2R,3S,4S)-2-[(4-methoxyphenyl)methyl]pyrrolidine-3,4-diol (CAS 27958-06-1) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: (2R,3S,4S)-2-[(4-methoxyphenyl)methyl]pyrrolidine-3,4-diol. InChIKey: UMWAPBCLJQSOJX-WOPDTQHZSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (2R,3S,4S)-2-[(4-methoxyphenyl)methyl]pyrrolidine-3,4-diol |
| InChIKey | UMWAPBCLJQSOJX-WOPDTQHZSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@@H]2[C@@H]([C@H](CN2)O)O |
Computed by PubChem (NCBI)